C19H31N5O4 — CID 111367697
N-ethyl-N'-[2-(furan-2-yl)-2-hydroxyethyl]-4-(2-morpholin-4-yl-2-oxoethyl)piperazine-1-carboximidamide (PubChem CID 111367697) has the molecular formula C19H31N5O4 and a molecular weight of 393.49 g/mol. Its IUPAC name is N-ethyl-N'-[2-(furan-2-yl)-2-hydroxyethyl]-4-(2-morpholin-4-yl-2-oxoethyl)piperazine-1-carboximidamide.
| Compound Name | N-ethyl-N'-[2-(furan-2-yl)-2-hydroxyethyl]-4-(2-morpholin-4-yl-2-oxoethyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111367697 |
| Molecular Formula | C19H31N5O4 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.24 |
| IUPAC Name | N-ethyl-N'-[2-(furan-2-yl)-2-hydroxyethyl]-4-(2-morpholin-4-yl-2-oxoethyl)piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CC(O)c1ccco1)N1CCN(CC(=O)N2CCOCC2)CC1 |
| InChI | InChI=1S/C19H31N5O4/c1-2-20-19(21-14-16(25)17-4-3-11-28-17)24-7-5-22(6-8-24)15-18(26)23-9-12-27-13-10-23/h3-4,11,16,25H,2,5-10,12-15H2,1H3,(H,20,21) |
| InChIKey | RXIXNIHCIJFNAE-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|