C24H39N5O2 — CID 111367631
N-ethyl-4-(2-morpholin-4-yl-2-oxoethyl)-N'-[2-(2,4,6-trimethylphenyl)ethyl]piperazine-1-carboximidamide (PubChem CID 111367631) has the molecular formula C24H39N5O2 and a molecular weight of 429.61 g/mol. Its IUPAC name is N-ethyl-4-(2-morpholin-4-yl-2-oxoethyl)-N'-[2-(2,4,6-trimethylphenyl)ethyl]piperazine-1-carboximidamide.
| Compound Name | N-ethyl-4-(2-morpholin-4-yl-2-oxoethyl)-N'-[2-(2,4,6-trimethylphenyl)ethyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111367631 |
| Molecular Formula | C24H39N5O2 |
| Molecular Weight | 429.61 g/mol |
| Exact Mass | 429.31 |
| IUPAC Name | N-ethyl-4-(2-morpholin-4-yl-2-oxoethyl)-N'-[2-(2,4,6-trimethylphenyl)ethyl]piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CCc1c(C)cc(C)cc1C)N1CCN(CC(=O)N2CCOCC2)CC1 |
| InChI | InChI=1S/C24H39N5O2/c1-5-25-24(26-7-6-22-20(3)16-19(2)17-21(22)4)29-10-8-27(9-11-29)18-23(30)28-12-14-31-15-13-28/h16-17H,5-15,18H2,1-4H3,(H,25,26) |
| InChIKey | DPBIMFMRNWPFOV-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 60.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.61 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|