C22H35N5O3 — CID 111367721
N-ethyl-N'-[2-hydroxy-2-(4-methylphenyl)ethyl]-4-(2-morpholin-4-yl-2-oxoethyl)piperazine-1-carboximidamide (PubChem CID 111367721) has the molecular formula C22H35N5O3 and a molecular weight of 417.55 g/mol. Its IUPAC name is N-ethyl-N'-[2-hydroxy-2-(4-methylphenyl)ethyl]-4-(2-morpholin-4-yl-2-oxoethyl)piperazine-1-carboximidamide.
| Compound Name | N-ethyl-N'-[2-hydroxy-2-(4-methylphenyl)ethyl]-4-(2-morpholin-4-yl-2-oxoethyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111367721 |
| Molecular Formula | C22H35N5O3 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.27 |
| IUPAC Name | N-ethyl-N'-[2-hydroxy-2-(4-methylphenyl)ethyl]-4-(2-morpholin-4-yl-2-oxoethyl)piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CC(O)c1ccc(C)cc1)N1CCN(CC(=O)N2CCOCC2)CC1 |
| InChI | InChI=1S/C22H35N5O3/c1-3-23-22(24-16-20(28)19-6-4-18(2)5-7-19)27-10-8-25(9-11-27)17-21(29)26-12-14-30-15-13-26/h4-7,20,28H,3,8-17H2,1-2H3,(H,23,24) |
| InChIKey | FFNLILBNMSTJCJ-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|