C23H37N5O3 — CID 111982375
N-ethyl-N'-[2-hydroxy-2-(3-methoxyphenyl)ethyl]-4-(2-oxo-2-piperidin-1-ylethyl)piperazine-1-carboximidamide (PubChem CID 111982375) has the molecular formula C23H37N5O3 and a molecular weight of 431.58 g/mol. Its IUPAC name is N-ethyl-N'-[2-hydroxy-2-(3-methoxyphenyl)ethyl]-4-(2-oxo-2-piperidin-1-ylethyl)piperazine-1-carboximidamide.
| Compound Name | N-ethyl-N'-[2-hydroxy-2-(3-methoxyphenyl)ethyl]-4-(2-oxo-2-piperidin-1-ylethyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111982375 |
| Molecular Formula | C23H37N5O3 |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.29 |
| IUPAC Name | N-ethyl-N'-[2-hydroxy-2-(3-methoxyphenyl)ethyl]-4-(2-oxo-2-piperidin-1-ylethyl)piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CC(O)c1cccc(OC)c1)N1CCN(CC(=O)N2CCCCC2)CC1 |
| InChI | InChI=1S/C23H37N5O3/c1-3-24-23(25-17-21(29)19-8-7-9-20(16-19)31-2)28-14-12-26(13-15-28)18-22(30)27-10-5-4-6-11-27/h7-9,16,21,29H,3-6,10-15,17-18H2,1-2H3,(H,24,25) |
| InChIKey | SXCXENCWUXZKRI-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|