C21H36N4O3 — CID 111981339
N'-[2-(3,5-dimethoxyphenyl)-2-hydroxyethyl]-N-ethyl-4-(2-methylpropyl)piperazine-1-carboximidamide (PubChem CID 111981339) has the molecular formula C21H36N4O3 and a molecular weight of 392.54 g/mol. Its IUPAC name is N'-[2-(3,5-dimethoxyphenyl)-2-hydroxyethyl]-N-ethyl-4-(2-methylpropyl)piperazine-1-carboximidamide.
| Compound Name | N'-[2-(3,5-dimethoxyphenyl)-2-hydroxyethyl]-N-ethyl-4-(2-methylpropyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111981339 |
| Molecular Formula | C21H36N4O3 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.28 |
| IUPAC Name | N'-[2-(3,5-dimethoxyphenyl)-2-hydroxyethyl]-N-ethyl-4-(2-methylpropyl)piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CC(O)c1cc(OC)cc(OC)c1)N1CCN(CC(C)C)CC1 |
| InChI | InChI=1S/C21H36N4O3/c1-6-22-21(25-9-7-24(8-10-25)15-16(2)3)23-14-20(26)17-11-18(27-4)13-19(12-17)28-5/h11-13,16,20,26H,6-10,14-15H2,1-5H3,(H,22,23) |
| InChIKey | SGPSMFNITYIZNE-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|