C19H29IN6O3 — CID 111379019
N-cyclopropyl-2-[4-[N-ethyl-N'-[(4-nitrophenyl)methyl]carbamimidoyl]piperazin-1-yl]acetamide;hydroiodide (PubChem CID 111379019) has the molecular formula C19H29IN6O3 and a molecular weight of 516.38 g/mol. Its IUPAC name is N-cyclopropyl-2-[4-[N-ethyl-N'-[(4-nitrophenyl)methyl]carbamimidoyl]piperazin-1-yl]acetamide;hydroiodide.
| Compound Name | N-cyclopropyl-2-[4-[N-ethyl-N'-[(4-nitrophenyl)methyl]carbamimidoyl]piperazin-1-yl]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111379019 |
| Molecular Formula | C19H29IN6O3 |
| Molecular Weight | 516.38 g/mol |
| Exact Mass | 516.13 |
| IUPAC Name | N-cyclopropyl-2-[4-[N-ethyl-N'-[(4-nitrophenyl)methyl]carbamimidoyl]piperazin-1-yl]acetamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc([N+](=O)[O-])cc1)N1CCN(CC(=O)NC2CC2)CC1.I |
| InChI | InChI=1S/C19H28N6O3.HI/c1-2-20-19(21-13-15-3-7-17(8-4-15)25(27)28)24-11-9-23(10-12-24)14-18(26)22-16-5-6-16;/h3-4,7-8,16H,2,5-6,9-14H2,1H3,(H,20,21)(H,22,26);1H |
| InChIKey | WMOZOXWBKKGYPM-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 103.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.38 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|