C21H33IN6O3 — CID 110021303
2-[4-[N-butan-2-yl-N'-[(4-nitrophenyl)methyl]carbamimidoyl]piperazin-1-yl]-N-cyclopropylacetamide;hydroiodide (PubChem CID 110021303) has the molecular formula C21H33IN6O3 and a molecular weight of 544.44 g/mol. Its IUPAC name is 2-[4-[N-butan-2-yl-N'-[(4-nitrophenyl)methyl]carbamimidoyl]piperazin-1-yl]-N-cyclopropylacetamide;hydroiodide.
| Compound Name | 2-[4-[N-butan-2-yl-N'-[(4-nitrophenyl)methyl]carbamimidoyl]piperazin-1-yl]-N-cyclopropylacetamide;hydroiodide |
|---|---|
| PubChem CID | 110021303 |
| Molecular Formula | C21H33IN6O3 |
| Molecular Weight | 544.44 g/mol |
| Exact Mass | 544.17 |
| IUPAC Name | 2-[4-[N-butan-2-yl-N'-[(4-nitrophenyl)methyl]carbamimidoyl]piperazin-1-yl]-N-cyclopropylacetamide;hydroiodide |
| SMILES | CCC(C)N/C(=N\Cc1ccc([N+](=O)[O-])cc1)N1CCN(CC(=O)NC2CC2)CC1.I |
| InChI | InChI=1S/C21H32N6O3.HI/c1-3-16(2)23-21(22-14-17-4-8-19(9-5-17)27(29)30)26-12-10-25(11-13-26)15-20(28)24-18-6-7-18;/h4-5,8-9,16,18H,3,6-7,10-15H2,1-2H3,(H,22,23)(H,24,28);1H |
| InChIKey | HMXUDVWPBGBDMP-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 103.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.44 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|