C17H28N6S — CID 111511174
1-butyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-1-methyl-2-(thiophen-2-ylmethyl)guanidine (PubChem CID 111511174) has the molecular formula C17H28N6S and a molecular weight of 348.52 g/mol. Its IUPAC name is 1-butyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-1-methyl-2-(thiophen-2-ylmethyl)guanidine.
| Compound Name | 1-butyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-1-methyl-2-(thiophen-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111511174 |
| Molecular Formula | C17H28N6S |
| Molecular Weight | 348.52 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | 1-butyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-1-methyl-2-(thiophen-2-ylmethyl)guanidine |
| SMILES | CCCCN(C)/C(=N\Cc1cccs1)NCCn1cnnc1CC |
| InChI | InChI=1S/C17H28N6S/c1-4-6-10-22(3)17(19-13-15-8-7-12-24-15)18-9-11-23-14-20-21-16(23)5-2/h7-8,12,14H,4-6,9-11,13H2,1-3H3,(H,18,19) |
| InChIKey | YMWYQKMAMJSCAX-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 58.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.52 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|