C17H24FN7 — CID 111148984
N-ethyl-4-(2-fluorophenyl)-N'-[(4-methyl-1,2,4-triazol-3-yl)methyl]piperazine-1-carboximidamide (PubChem CID 111148984) has the molecular formula C17H24FN7 and a molecular weight of 345.43 g/mol. Its IUPAC name is N-ethyl-4-(2-fluorophenyl)-N'-[(4-methyl-1,2,4-triazol-3-yl)methyl]piperazine-1-carboximidamide.
| Compound Name | N-ethyl-4-(2-fluorophenyl)-N'-[(4-methyl-1,2,4-triazol-3-yl)methyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111148984 |
| Molecular Formula | C17H24FN7 |
| Molecular Weight | 345.43 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | N-ethyl-4-(2-fluorophenyl)-N'-[(4-methyl-1,2,4-triazol-3-yl)methyl]piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1nncn1C)N1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C17H24FN7/c1-3-19-17(20-12-16-22-21-13-23(16)2)25-10-8-24(9-11-25)15-7-5-4-6-14(15)18/h4-7,13H,3,8-12H2,1-2H3,(H,19,20) |
| InChIKey | NEQOCRIJRBLVBT-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 61.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.43 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|