C18H27N7O — CID 111185812
N-ethyl-N'-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-4-(2-hydroxyphenyl)piperazine-1-carboximidamide (PubChem CID 111185812) has the molecular formula C18H27N7O and a molecular weight of 357.46 g/mol. Its IUPAC name is N-ethyl-N'-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-4-(2-hydroxyphenyl)piperazine-1-carboximidamide.
| Compound Name | N-ethyl-N'-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-4-(2-hydroxyphenyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111185812 |
| Molecular Formula | C18H27N7O |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.23 |
| IUPAC Name | N-ethyl-N'-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-4-(2-hydroxyphenyl)piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1nncn1CC)N1CCN(c2ccccc2O)CC1 |
| InChI | InChI=1S/C18H27N7O/c1-3-19-18(20-13-17-22-21-14-23(17)4-2)25-11-9-24(10-12-25)15-7-5-6-8-16(15)26/h5-8,14,26H,3-4,9-13H2,1-2H3,(H,19,20) |
| InChIKey | BFQUWZXROACJQB-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 81.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|