C18H26IN5OS — CID 111511816
N-ethyl-4-(2-hydroxyphenyl)-N'-[(5-methyl-1,3-thiazol-2-yl)methyl]piperazine-1-carboximidamide;hydroiodide (PubChem CID 111511816) has the molecular formula C18H26IN5OS and a molecular weight of 487.41 g/mol. Its IUPAC name is N-ethyl-4-(2-hydroxyphenyl)-N'-[(5-methyl-1,3-thiazol-2-yl)methyl]piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-4-(2-hydroxyphenyl)-N'-[(5-methyl-1,3-thiazol-2-yl)methyl]piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111511816 |
| Molecular Formula | C18H26IN5OS |
| Molecular Weight | 487.41 g/mol |
| Exact Mass | 487.09 |
| IUPAC Name | N-ethyl-4-(2-hydroxyphenyl)-N'-[(5-methyl-1,3-thiazol-2-yl)methyl]piperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ncc(C)s1)N1CCN(c2ccccc2O)CC1.I |
| InChI | InChI=1S/C18H25N5OS.HI/c1-3-19-18(21-13-17-20-12-14(2)25-17)23-10-8-22(9-11-23)15-6-4-5-7-16(15)24;/h4-7,12,24H,3,8-11,13H2,1-2H3,(H,19,21);1H |
| InChIKey | ZKZGZXICOWUNGH-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.41 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|