C18H26F2IN7 — CID 109450898
4-(2,5-difluorophenyl)-N-ethyl-N'-[(4-ethyl-1,2,4-triazol-3-yl)methyl]piperazine-1-carboximidamide;hydroiodide (PubChem CID 109450898) has the molecular formula C18H26F2IN7 and a molecular weight of 505.36 g/mol. Its IUPAC name is 4-(2,5-difluorophenyl)-N-ethyl-N'-[(4-ethyl-1,2,4-triazol-3-yl)methyl]piperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-(2,5-difluorophenyl)-N-ethyl-N'-[(4-ethyl-1,2,4-triazol-3-yl)methyl]piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109450898 |
| Molecular Formula | C18H26F2IN7 |
| Molecular Weight | 505.36 g/mol |
| Exact Mass | 505.13 |
| IUPAC Name | 4-(2,5-difluorophenyl)-N-ethyl-N'-[(4-ethyl-1,2,4-triazol-3-yl)methyl]piperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1nncn1CC)N1CCN(c2cc(F)ccc2F)CC1.I |
| InChI | InChI=1S/C18H25F2N7.HI/c1-3-21-18(22-12-17-24-23-13-25(17)4-2)27-9-7-26(8-10-27)16-11-14(19)5-6-15(16)20;/h5-6,11,13H,3-4,7-10,12H2,1-2H3,(H,21,22);1H |
| InChIKey | PFIYLBIBIRRCIE-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 61.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.36 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|