C19H26F2IN7O2 — CID 109451626
methyl 2-[4-[[[[4-(2,5-difluorophenyl)piperazin-1-yl]-(ethylamino)methylidene]amino]methyl]triazol-1-yl]acetate;hydroiodide (PubChem CID 109451626) has the molecular formula C19H26F2IN7O2 and a molecular weight of 549.36 g/mol. Its IUPAC name is methyl 2-[4-[[[[4-(2,5-difluorophenyl)piperazin-1-yl]-(ethylamino)methylidene]amino]methyl]triazol-1-yl]acetate;hydroiodide.
| Compound Name | methyl 2-[4-[[[[4-(2,5-difluorophenyl)piperazin-1-yl]-(ethylamino)methylidene]amino]methyl]triazol-1-yl]acetate;hydroiodide |
|---|---|
| PubChem CID | 109451626 |
| Molecular Formula | C19H26F2IN7O2 |
| Molecular Weight | 549.36 g/mol |
| Exact Mass | 549.12 |
| IUPAC Name | methyl 2-[4-[[[[4-(2,5-difluorophenyl)piperazin-1-yl]-(ethylamino)methylidene]amino]methyl]triazol-1-yl]acetate;hydroiodide |
| SMILES | CCN/C(=N\Cc1cn(CC(=O)OC)nn1)N1CCN(c2cc(F)ccc2F)CC1.I |
| InChI | InChI=1S/C19H25F2N7O2.HI/c1-3-22-19(23-11-15-12-28(25-24-15)13-18(29)30-2)27-8-6-26(7-9-27)17-10-14(20)4-5-16(17)21;/h4-5,10,12H,3,6-9,11,13H2,1-2H3,(H,22,23);1H |
| InChIKey | ZCOGCESVAIXMKV-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 87.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.36 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|