C23H34FN7O — CID 111517747
N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-4-[(3-fluoro-4-methoxyphenyl)methyl]-N'-(2-methylprop-2-enyl)piperazine-1-carboximidamide (PubChem CID 111517747) has the molecular formula C23H34FN7O and a molecular weight of 443.57 g/mol. Its IUPAC name is N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-4-[(3-fluoro-4-methoxyphenyl)methyl]-N'-(2-methylprop-2-enyl)piperazine-1-carboximidamide.
| Compound Name | N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-4-[(3-fluoro-4-methoxyphenyl)methyl]-N'-(2-methylprop-2-enyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111517747 |
| Molecular Formula | C23H34FN7O |
| Molecular Weight | 443.57 g/mol |
| Exact Mass | 443.28 |
| IUPAC Name | N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-4-[(3-fluoro-4-methoxyphenyl)methyl]-N'-(2-methylprop-2-enyl)piperazine-1-carboximidamide |
| SMILES | C=C(C)C/N=C(\NCCn1cnnc1CC)N1CCN(Cc2ccc(OC)c(F)c2)CC1 |
| InChI | InChI=1S/C23H34FN7O/c1-5-22-28-27-17-31(22)9-8-25-23(26-15-18(2)3)30-12-10-29(11-13-30)16-19-6-7-21(32-4)20(24)14-19/h6-7,14,17H,2,5,8-13,15-16H2,1,3-4H3,(H,25,26) |
| InChIKey | HIAQFPAOKYAWMI-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 70.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.57 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|