C21H32FN5O2 — CID 111367479
2-[[[4-[(3-fluoro-4-methoxyphenyl)methyl]piperazin-1-yl]-(2-methylprop-2-enylamino)methylidene]amino]-N,N-dimethylacetamide (PubChem CID 111367479) has the molecular formula C21H32FN5O2 and a molecular weight of 405.52 g/mol. Its IUPAC name is 2-[[[4-[(3-fluoro-4-methoxyphenyl)methyl]piperazin-1-yl]-(2-methylprop-2-enylamino)methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[[4-[(3-fluoro-4-methoxyphenyl)methyl]piperazin-1-yl]-(2-methylprop-2-enylamino)methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 111367479 |
| Molecular Formula | C21H32FN5O2 |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.25 |
| IUPAC Name | 2-[[[4-[(3-fluoro-4-methoxyphenyl)methyl]piperazin-1-yl]-(2-methylprop-2-enylamino)methylidene]amino]-N,N-dimethylacetamide |
| SMILES | C=C(C)CN/C(=N\CC(=O)N(C)C)N1CCN(Cc2ccc(OC)c(F)c2)CC1 |
| InChI | InChI=1S/C21H32FN5O2/c1-16(2)13-23-21(24-14-20(28)25(3)4)27-10-8-26(9-11-27)15-17-6-7-19(29-5)18(22)12-17/h6-7,12H,1,8-11,13-15H2,2-5H3,(H,23,24) |
| InChIKey | FQQSIQXDWSODDS-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 60.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|