C19H31FN4O4S — CID 111517761
4-[(3-fluoro-4-methoxyphenyl)methyl]-N'-methyl-N-[2-(2-methylsulfonylethoxy)ethyl]piperazine-1-carboximidamide (PubChem CID 111517761) has the molecular formula C19H31FN4O4S and a molecular weight of 430.55 g/mol. Its IUPAC name is 4-[(3-fluoro-4-methoxyphenyl)methyl]-N'-methyl-N-[2-(2-methylsulfonylethoxy)ethyl]piperazine-1-carboximidamide.
| Compound Name | 4-[(3-fluoro-4-methoxyphenyl)methyl]-N'-methyl-N-[2-(2-methylsulfonylethoxy)ethyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111517761 |
| Molecular Formula | C19H31FN4O4S |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | 4-[(3-fluoro-4-methoxyphenyl)methyl]-N'-methyl-N-[2-(2-methylsulfonylethoxy)ethyl]piperazine-1-carboximidamide |
| SMILES | C/N=C(\NCCOCCS(C)(=O)=O)N1CCN(Cc2ccc(OC)c(F)c2)CC1 |
| InChI | InChI=1S/C19H31FN4O4S/c1-21-19(22-6-11-28-12-13-29(3,25)26)24-9-7-23(8-10-24)15-16-4-5-18(27-2)17(20)14-16/h4-5,14H,6-13,15H2,1-3H3,(H,21,22) |
| InChIKey | LTQDJZKQXASZBF-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|