C15H33IN4O3S — CID 111516164
N'-methyl-4-(2-methylpropyl)-N-[2-(2-methylsulfonylethoxy)ethyl]piperazine-1-carboximidamide;hydroiodide (PubChem CID 111516164) has the molecular formula C15H33IN4O3S and a molecular weight of 476.43 g/mol. Its IUPAC name is N'-methyl-4-(2-methylpropyl)-N-[2-(2-methylsulfonylethoxy)ethyl]piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N'-methyl-4-(2-methylpropyl)-N-[2-(2-methylsulfonylethoxy)ethyl]piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111516164 |
| Molecular Formula | C15H33IN4O3S |
| Molecular Weight | 476.43 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | N'-methyl-4-(2-methylpropyl)-N-[2-(2-methylsulfonylethoxy)ethyl]piperazine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCCOCCS(C)(=O)=O)N1CCN(CC(C)C)CC1.I |
| InChI | InChI=1S/C15H32N4O3S.HI/c1-14(2)13-18-6-8-19(9-7-18)15(16-3)17-5-10-22-11-12-23(4,20)21;/h14H,5-13H2,1-4H3,(H,16,17);1H |
| InChIKey | XPXHSUBQXCKRLU-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 74.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.43 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|