C15H30IN3O5S — CID 111511095
ethyl 1-[N'-methyl-N-[2-(2-methylsulfonylethoxy)ethyl]carbamimidoyl]piperidine-4-carboxylate;hydroiodide (PubChem CID 111511095) has the molecular formula C15H30IN3O5S and a molecular weight of 491.39 g/mol. Its IUPAC name is ethyl 1-[N'-methyl-N-[2-(2-methylsulfonylethoxy)ethyl]carbamimidoyl]piperidine-4-carboxylate;hydroiodide.
| Compound Name | ethyl 1-[N'-methyl-N-[2-(2-methylsulfonylethoxy)ethyl]carbamimidoyl]piperidine-4-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111511095 |
| Molecular Formula | C15H30IN3O5S |
| Molecular Weight | 491.39 g/mol |
| Exact Mass | 491.10 |
| IUPAC Name | ethyl 1-[N'-methyl-N-[2-(2-methylsulfonylethoxy)ethyl]carbamimidoyl]piperidine-4-carboxylate;hydroiodide |
| SMILES | CCOC(=O)C1CCN(/C(=N/C)NCCOCCS(C)(=O)=O)CC1.I |
| InChI | InChI=1S/C15H29N3O5S.HI/c1-4-23-14(19)13-5-8-18(9-6-13)15(16-2)17-7-10-22-11-12-24(3,20)21;/h13H,4-12H2,1-3H3,(H,16,17);1H |
| InChIKey | DSZNEGPDLDGOLW-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.39 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|