C11H26IN3O3S — CID 111492005
1-butan-2-yl-2-methyl-3-[2-(2-methylsulfonylethoxy)ethyl]guanidine;hydroiodide (PubChem CID 111492005) has the molecular formula C11H26IN3O3S and a molecular weight of 407.32 g/mol. Its IUPAC name is 1-butan-2-yl-2-methyl-3-[2-(2-methylsulfonylethoxy)ethyl]guanidine;hydroiodide.
| Compound Name | 1-butan-2-yl-2-methyl-3-[2-(2-methylsulfonylethoxy)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111492005 |
| Molecular Formula | C11H26IN3O3S |
| Molecular Weight | 407.32 g/mol |
| Exact Mass | 407.07 |
| IUPAC Name | 1-butan-2-yl-2-methyl-3-[2-(2-methylsulfonylethoxy)ethyl]guanidine;hydroiodide |
| SMILES | CCC(C)N/C(=N\C)NCCOCCS(C)(=O)=O.I |
| InChI | InChI=1S/C11H25N3O3S.HI/c1-5-10(2)14-11(12-3)13-6-7-17-8-9-18(4,15)16;/h10H,5-9H2,1-4H3,(H2,12,13,14);1H |
| InChIKey | HFJPBIVYBIEAFZ-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.32 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|