C23H31F2IN4O2 — CID 111367474
N-ethyl-4-[(3-fluoro-4-methoxyphenyl)methyl]-N'-[2-(2-fluorophenyl)-2-hydroxyethyl]piperazine-1-carboximidamide;hydroiodide (PubChem CID 111367474) has the molecular formula C23H31F2IN4O2 and a molecular weight of 560.43 g/mol. Its IUPAC name is N-ethyl-4-[(3-fluoro-4-methoxyphenyl)methyl]-N'-[2-(2-fluorophenyl)-2-hydroxyethyl]piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-4-[(3-fluoro-4-methoxyphenyl)methyl]-N'-[2-(2-fluorophenyl)-2-hydroxyethyl]piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111367474 |
| Molecular Formula | C23H31F2IN4O2 |
| Molecular Weight | 560.43 g/mol |
| Exact Mass | 560.15 |
| IUPAC Name | N-ethyl-4-[(3-fluoro-4-methoxyphenyl)methyl]-N'-[2-(2-fluorophenyl)-2-hydroxyethyl]piperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CC(O)c1ccccc1F)N1CCN(Cc2ccc(OC)c(F)c2)CC1.I |
| InChI | InChI=1S/C23H30F2N4O2.HI/c1-3-26-23(27-15-21(30)18-6-4-5-7-19(18)24)29-12-10-28(11-13-29)16-17-8-9-22(31-2)20(25)14-17;/h4-9,14,21,30H,3,10-13,15-16H2,1-2H3,(H,26,27);1H |
| InChIKey | KSAADKVJGXWQGT-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.43 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|