C23H31FN4O3 — CID 111979749
N'-[2-(3,4-dimethoxyphenyl)-2-hydroxyethyl]-N-ethyl-4-(2-fluorophenyl)piperazine-1-carboximidamide (PubChem CID 111979749) has the molecular formula C23H31FN4O3 and a molecular weight of 430.52 g/mol. Its IUPAC name is N'-[2-(3,4-dimethoxyphenyl)-2-hydroxyethyl]-N-ethyl-4-(2-fluorophenyl)piperazine-1-carboximidamide.
| Compound Name | N'-[2-(3,4-dimethoxyphenyl)-2-hydroxyethyl]-N-ethyl-4-(2-fluorophenyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111979749 |
| Molecular Formula | C23H31FN4O3 |
| Molecular Weight | 430.52 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | N'-[2-(3,4-dimethoxyphenyl)-2-hydroxyethyl]-N-ethyl-4-(2-fluorophenyl)piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CC(O)c1ccc(OC)c(OC)c1)N1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C23H31FN4O3/c1-4-25-23(26-16-20(29)17-9-10-21(30-2)22(15-17)31-3)28-13-11-27(12-14-28)19-8-6-5-7-18(19)24/h5-10,15,20,29H,4,11-14,16H2,1-3H3,(H,25,26) |
| InChIKey | BHUFLLSMODSJDH-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.52 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|