C19H32FIN4O — CID 111148462
N-ethyl-4-(2-fluorophenyl)-N'-(3-propan-2-yloxypropyl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 111148462) has the molecular formula C19H32FIN4O and a molecular weight of 478.39 g/mol. Its IUPAC name is N-ethyl-4-(2-fluorophenyl)-N'-(3-propan-2-yloxypropyl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-4-(2-fluorophenyl)-N'-(3-propan-2-yloxypropyl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111148462 |
| Molecular Formula | C19H32FIN4O |
| Molecular Weight | 478.39 g/mol |
| Exact Mass | 478.16 |
| IUPAC Name | N-ethyl-4-(2-fluorophenyl)-N'-(3-propan-2-yloxypropyl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCCOC(C)C)N1CCN(c2ccccc2F)CC1.I |
| InChI | InChI=1S/C19H31FN4O.HI/c1-4-21-19(22-10-7-15-25-16(2)3)24-13-11-23(12-14-24)18-9-6-5-8-17(18)20;/h5-6,8-9,16H,4,7,10-15H2,1-3H3,(H,21,22);1H |
| InChIKey | RTRCZWVXNZPJCK-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.39 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|