C18H26F4N4O — CID 111148361
N-ethyl-4-(2-fluorophenyl)-N'-[3-(2,2,2-trifluoroethoxy)propyl]piperazine-1-carboximidamide (PubChem CID 111148361) has the molecular formula C18H26F4N4O and a molecular weight of 390.43 g/mol. Its IUPAC name is N-ethyl-4-(2-fluorophenyl)-N'-[3-(2,2,2-trifluoroethoxy)propyl]piperazine-1-carboximidamide.
| Compound Name | N-ethyl-4-(2-fluorophenyl)-N'-[3-(2,2,2-trifluoroethoxy)propyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111148361 |
| Molecular Formula | C18H26F4N4O |
| Molecular Weight | 390.43 g/mol |
| Exact Mass | 390.20 |
| IUPAC Name | N-ethyl-4-(2-fluorophenyl)-N'-[3-(2,2,2-trifluoroethoxy)propyl]piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CCCOCC(F)(F)F)N1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C18H26F4N4O/c1-2-23-17(24-8-5-13-27-14-18(20,21)22)26-11-9-25(10-12-26)16-7-4-3-6-15(16)19/h3-4,6-7H,2,5,8-14H2,1H3,(H,23,24) |
| InChIKey | LKHWQNQHCKBJLV-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.43 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|