C20H30FN5O — CID 111148669
N-ethyl-4-(2-fluorophenyl)-N'-(3-oxo-3-pyrrolidin-1-ylpropyl)piperazine-1-carboximidamide (PubChem CID 111148669) has the molecular formula C20H30FN5O and a molecular weight of 375.49 g/mol. Its IUPAC name is N-ethyl-4-(2-fluorophenyl)-N'-(3-oxo-3-pyrrolidin-1-ylpropyl)piperazine-1-carboximidamide.
| Compound Name | N-ethyl-4-(2-fluorophenyl)-N'-(3-oxo-3-pyrrolidin-1-ylpropyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111148669 |
| Molecular Formula | C20H30FN5O |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.24 |
| IUPAC Name | N-ethyl-4-(2-fluorophenyl)-N'-(3-oxo-3-pyrrolidin-1-ylpropyl)piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CCC(=O)N1CCCC1)N1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C20H30FN5O/c1-2-22-20(23-10-9-19(27)25-11-5-6-12-25)26-15-13-24(14-16-26)18-8-4-3-7-17(18)21/h3-4,7-8H,2,5-6,9-16H2,1H3,(H,22,23) |
| InChIKey | BLJXXYGPGYKGQZ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 51.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|