C19H33FIN5O — CID 111149023
N-ethyl-4-(2-fluorophenyl)-N'-[2-[2-methoxyethyl(methyl)amino]ethyl]piperazine-1-carboximidamide;hydroiodide (PubChem CID 111149023) has the molecular formula C19H33FIN5O and a molecular weight of 493.41 g/mol. Its IUPAC name is N-ethyl-4-(2-fluorophenyl)-N'-[2-[2-methoxyethyl(methyl)amino]ethyl]piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-4-(2-fluorophenyl)-N'-[2-[2-methoxyethyl(methyl)amino]ethyl]piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111149023 |
| Molecular Formula | C19H33FIN5O |
| Molecular Weight | 493.41 g/mol |
| Exact Mass | 493.17 |
| IUPAC Name | N-ethyl-4-(2-fluorophenyl)-N'-[2-[2-methoxyethyl(methyl)amino]ethyl]piperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCN(C)CCOC)N1CCN(c2ccccc2F)CC1.I |
| InChI | InChI=1S/C19H32FN5O.HI/c1-4-21-19(22-9-10-23(2)15-16-26-3)25-13-11-24(12-14-25)18-8-6-5-7-17(18)20;/h5-8H,4,9-16H2,1-3H3,(H,21,22);1H |
| InChIKey | GIIHVBQPKMDJTF-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 43.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.41 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|