C19H31ClN4O2 — CID 111177610
4-(2-chlorophenyl)-N-ethyl-N'-[3-(2-methoxyethoxy)propyl]piperazine-1-carboximidamide (PubChem CID 111177610) has the molecular formula C19H31ClN4O2 and a molecular weight of 382.94 g/mol. Its IUPAC name is 4-(2-chlorophenyl)-N-ethyl-N'-[3-(2-methoxyethoxy)propyl]piperazine-1-carboximidamide.
| Compound Name | 4-(2-chlorophenyl)-N-ethyl-N'-[3-(2-methoxyethoxy)propyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111177610 |
| Molecular Formula | C19H31ClN4O2 |
| Molecular Weight | 382.94 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | 4-(2-chlorophenyl)-N-ethyl-N'-[3-(2-methoxyethoxy)propyl]piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CCCOCCOC)N1CCN(c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C19H31ClN4O2/c1-3-21-19(22-9-6-14-26-16-15-25-2)24-12-10-23(11-13-24)18-8-5-4-7-17(18)20/h4-5,7-8H,3,6,9-16H2,1-2H3,(H,21,22) |
| InChIKey | XJGJOROFRXTHAB-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.94 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|