C24H31FIN5O2 — CID 111498835
N'-[(5-cyano-2-fluorophenyl)methyl]-4-[(3,4-dimethoxyphenyl)methyl]-N-ethylpiperazine-1-carboximidamide;hydroiodide (PubChem CID 111498835) has the molecular formula C24H31FIN5O2 and a molecular weight of 567.45 g/mol. Its IUPAC name is N'-[(5-cyano-2-fluorophenyl)methyl]-4-[(3,4-dimethoxyphenyl)methyl]-N-ethylpiperazine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[(5-cyano-2-fluorophenyl)methyl]-4-[(3,4-dimethoxyphenyl)methyl]-N-ethylpiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111498835 |
| Molecular Formula | C24H31FIN5O2 |
| Molecular Weight | 567.45 g/mol |
| Exact Mass | 567.15 |
| IUPAC Name | N'-[(5-cyano-2-fluorophenyl)methyl]-4-[(3,4-dimethoxyphenyl)methyl]-N-ethylpiperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cc(C#N)ccc1F)N1CCN(Cc2ccc(OC)c(OC)c2)CC1.I |
| InChI | InChI=1S/C24H30FN5O2.HI/c1-4-27-24(28-16-20-13-18(15-26)5-7-21(20)25)30-11-9-29(10-12-30)17-19-6-8-22(31-2)23(14-19)32-3;/h5-8,13-14H,4,9-12,16-17H2,1-3H3,(H,27,28);1H |
| InChIKey | VJBYUSMBPOSROY-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 73.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.45 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|