C15H19FN4 — CID 111493054
N'-[(5-cyano-2-fluorophenyl)methyl]-N-ethylpyrrolidine-1-carboximidamide (PubChem CID 111493054) has the molecular formula C15H19FN4 and a molecular weight of 274.34 g/mol. Its IUPAC name is N'-[(5-cyano-2-fluorophenyl)methyl]-N-ethylpyrrolidine-1-carboximidamide.
| Compound Name | N'-[(5-cyano-2-fluorophenyl)methyl]-N-ethylpyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111493054 |
| Molecular Formula | C15H19FN4 |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | N'-[(5-cyano-2-fluorophenyl)methyl]-N-ethylpyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1cc(C#N)ccc1F)N1CCCC1 |
| InChI | InChI=1S/C15H19FN4/c1-2-18-15(20-7-3-4-8-20)19-11-13-9-12(10-17)5-6-14(13)16/h5-6,9H,2-4,7-8,11H2,1H3,(H,18,19) |
| InChIKey | BFGRGGZZCGWMMF-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 51.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|