C20H29FIN5O — CID 111997934
N'-[(5-cyano-2-fluorophenyl)methyl]-N-ethyl-3-(morpholin-4-ylmethyl)pyrrolidine-1-carboximidamide;hydroiodide (PubChem CID 111997934) has the molecular formula C20H29FIN5O and a molecular weight of 501.39 g/mol. Its IUPAC name is N'-[(5-cyano-2-fluorophenyl)methyl]-N-ethyl-3-(morpholin-4-ylmethyl)pyrrolidine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[(5-cyano-2-fluorophenyl)methyl]-N-ethyl-3-(morpholin-4-ylmethyl)pyrrolidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111997934 |
| Molecular Formula | C20H29FIN5O |
| Molecular Weight | 501.39 g/mol |
| Exact Mass | 501.14 |
| IUPAC Name | N'-[(5-cyano-2-fluorophenyl)methyl]-N-ethyl-3-(morpholin-4-ylmethyl)pyrrolidine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cc(C#N)ccc1F)N1CCC(CN2CCOCC2)C1.I |
| InChI | InChI=1S/C20H28FN5O.HI/c1-2-23-20(24-13-18-11-16(12-22)3-4-19(18)21)26-6-5-17(15-26)14-25-7-9-27-10-8-25;/h3-4,11,17H,2,5-10,13-15H2,1H3,(H,23,24);1H |
| InChIKey | RASZSEYDFXBUAQ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 63.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.39 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|