C23H38N4O3 — CID 111747404
N-ethyl-3-(2-methoxyethoxymethyl)-N'-[[2-(morpholin-4-ylmethyl)phenyl]methyl]pyrrolidine-1-carboximidamide (PubChem CID 111747404) has the molecular formula C23H38N4O3 and a molecular weight of 418.58 g/mol. Its IUPAC name is N-ethyl-3-(2-methoxyethoxymethyl)-N'-[[2-(morpholin-4-ylmethyl)phenyl]methyl]pyrrolidine-1-carboximidamide.
| Compound Name | N-ethyl-3-(2-methoxyethoxymethyl)-N'-[[2-(morpholin-4-ylmethyl)phenyl]methyl]pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111747404 |
| Molecular Formula | C23H38N4O3 |
| Molecular Weight | 418.58 g/mol |
| Exact Mass | 418.29 |
| IUPAC Name | N-ethyl-3-(2-methoxyethoxymethyl)-N'-[[2-(morpholin-4-ylmethyl)phenyl]methyl]pyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1ccccc1CN1CCOCC1)N1CCC(COCCOC)C1 |
| InChI | InChI=1S/C23H38N4O3/c1-3-24-23(27-9-8-20(17-27)19-30-15-14-28-2)25-16-21-6-4-5-7-22(21)18-26-10-12-29-13-11-26/h4-7,20H,3,8-19H2,1-2H3,(H,24,25) |
| InChIKey | RRVOYAAZWSDTJF-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.58 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|