C21H36IN3O5 — CID 111746722
N-ethyl-3-(2-methoxyethoxymethyl)-N'-[(2,3,4-trimethoxyphenyl)methyl]pyrrolidine-1-carboximidamide;hydroiodide (PubChem CID 111746722) has the molecular formula C21H36IN3O5 and a molecular weight of 537.44 g/mol. Its IUPAC name is N-ethyl-3-(2-methoxyethoxymethyl)-N'-[(2,3,4-trimethoxyphenyl)methyl]pyrrolidine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-3-(2-methoxyethoxymethyl)-N'-[(2,3,4-trimethoxyphenyl)methyl]pyrrolidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111746722 |
| Molecular Formula | C21H36IN3O5 |
| Molecular Weight | 537.44 g/mol |
| Exact Mass | 537.17 |
| IUPAC Name | N-ethyl-3-(2-methoxyethoxymethyl)-N'-[(2,3,4-trimethoxyphenyl)methyl]pyrrolidine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(OC)c(OC)c1OC)N1CCC(COCCOC)C1.I |
| InChI | InChI=1S/C21H35N3O5.HI/c1-6-22-21(24-10-9-16(14-24)15-29-12-11-25-2)23-13-17-7-8-18(26-3)20(28-5)19(17)27-4;/h7-8,16H,6,9-15H2,1-5H3,(H,22,23);1H |
| InChIKey | UIOQYWIDYROOQA-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 73.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.44 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|