C21H35IN6O2 — CID 111514677
2-butyl-1-[(2,4-dimethoxyphenyl)methyl]-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-1-methylguanidine;hydroiodide (PubChem CID 111514677) has the molecular formula C21H35IN6O2 and a molecular weight of 530.46 g/mol. Its IUPAC name is 2-butyl-1-[(2,4-dimethoxyphenyl)methyl]-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-1-methylguanidine;hydroiodide.
| Compound Name | 2-butyl-1-[(2,4-dimethoxyphenyl)methyl]-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-1-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111514677 |
| Molecular Formula | C21H35IN6O2 |
| Molecular Weight | 530.46 g/mol |
| Exact Mass | 530.19 |
| IUPAC Name | 2-butyl-1-[(2,4-dimethoxyphenyl)methyl]-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-1-methylguanidine;hydroiodide |
| SMILES | CCCC/N=C(\NCCn1cnnc1CC)N(C)Cc1ccc(OC)cc1OC.I |
| InChI | InChI=1S/C21H34N6O2.HI/c1-6-8-11-22-21(23-12-13-27-16-24-25-20(27)7-2)26(3)15-17-9-10-18(28-4)14-19(17)29-5;/h9-10,14,16H,6-8,11-13,15H2,1-5H3,(H,22,23);1H |
| InChIKey | UDHNWVHNVOFORB-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 76.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.46 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|