C18H35N7O — CID 111518447
N-tert-butyl-2-[[N'-butyl-N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]carbamimidoyl]-methylamino]acetamide (PubChem CID 111518447) has the molecular formula C18H35N7O and a molecular weight of 365.53 g/mol. Its IUPAC name is N-tert-butyl-2-[[N'-butyl-N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]carbamimidoyl]-methylamino]acetamide.
| Compound Name | N-tert-butyl-2-[[N'-butyl-N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]carbamimidoyl]-methylamino]acetamide |
|---|---|
| PubChem CID | 111518447 |
| Molecular Formula | C18H35N7O |
| Molecular Weight | 365.53 g/mol |
| Exact Mass | 365.29 |
| IUPAC Name | N-tert-butyl-2-[[N'-butyl-N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]carbamimidoyl]-methylamino]acetamide |
| SMILES | CCCC/N=C(/NCCn1cnnc1CC)N(C)CC(=O)NC(C)(C)C |
| InChI | InChI=1S/C18H35N7O/c1-7-9-10-19-17(24(6)13-16(26)22-18(3,4)5)20-11-12-25-14-21-23-15(25)8-2/h14H,7-13H2,1-6H3,(H,19,20)(H,22,26) |
| InChIKey | XWTHZZRZBHIQIM-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 87.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.53 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|