C18H30N6OS — CID 111518241
2-(3-ethoxypropyl)-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-1-methyl-1-(thiophen-3-ylmethyl)guanidine (PubChem CID 111518241) has the molecular formula C18H30N6OS and a molecular weight of 378.55 g/mol. Its IUPAC name is 2-(3-ethoxypropyl)-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-1-methyl-1-(thiophen-3-ylmethyl)guanidine.
| Compound Name | 2-(3-ethoxypropyl)-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-1-methyl-1-(thiophen-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111518241 |
| Molecular Formula | C18H30N6OS |
| Molecular Weight | 378.55 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | 2-(3-ethoxypropyl)-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-1-methyl-1-(thiophen-3-ylmethyl)guanidine |
| SMILES | CCOCCC/N=C(/NCCn1cnnc1CC)N(C)Cc1ccsc1 |
| InChI | InChI=1S/C18H30N6OS/c1-4-17-22-21-15-24(17)10-9-20-18(19-8-6-11-25-5-2)23(3)13-16-7-12-26-14-16/h7,12,14-15H,4-6,8-11,13H2,1-3H3,(H,19,20) |
| InChIKey | MVABJULOSQOQGK-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 67.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.55 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|