C18H36IN7O — CID 111510044
2-[[N'-butyl-N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]carbamimidoyl]-methylamino]-N,N-diethylacetamide;hydroiodide (PubChem CID 111510044) has the molecular formula C18H36IN7O and a molecular weight of 493.44 g/mol. Its IUPAC name is 2-[[N'-butyl-N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]carbamimidoyl]-methylamino]-N,N-diethylacetamide;hydroiodide.
| Compound Name | 2-[[N'-butyl-N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]carbamimidoyl]-methylamino]-N,N-diethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 111510044 |
| Molecular Formula | C18H36IN7O |
| Molecular Weight | 493.44 g/mol |
| Exact Mass | 493.20 |
| IUPAC Name | 2-[[N'-butyl-N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]carbamimidoyl]-methylamino]-N,N-diethylacetamide;hydroiodide |
| SMILES | CCCC/N=C(/NCCn1cnnc1CC)N(C)CC(=O)N(CC)CC.I |
| InChI | InChI=1S/C18H35N7O.HI/c1-6-10-11-19-18(23(5)14-17(26)24(8-3)9-4)20-12-13-25-15-21-22-16(25)7-2;/h15H,6-14H2,1-5H3,(H,19,20);1H |
| InChIKey | PHDIXIIQZHXVTR-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 78.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.44 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|