C19H22BrN5S — CID 111361029
4-[(5-bromothiophen-2-yl)methyl]-N-[(4-cyanophenyl)methyl]-N'-methylpiperazine-1-carboximidamide (PubChem CID 111361029) has the molecular formula C19H22BrN5S and a molecular weight of 432.39 g/mol. Its IUPAC name is 4-[(5-bromothiophen-2-yl)methyl]-N-[(4-cyanophenyl)methyl]-N'-methylpiperazine-1-carboximidamide.
| Compound Name | 4-[(5-bromothiophen-2-yl)methyl]-N-[(4-cyanophenyl)methyl]-N'-methylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111361029 |
| Molecular Formula | C19H22BrN5S |
| Molecular Weight | 432.39 g/mol |
| Exact Mass | 431.08 |
| IUPAC Name | 4-[(5-bromothiophen-2-yl)methyl]-N-[(4-cyanophenyl)methyl]-N'-methylpiperazine-1-carboximidamide |
| SMILES | C/N=C(\NCc1ccc(C#N)cc1)N1CCN(Cc2ccc(Br)s2)CC1 |
| InChI | InChI=1S/C19H22BrN5S/c1-22-19(23-13-16-4-2-15(12-21)3-5-16)25-10-8-24(9-11-25)14-17-6-7-18(20)26-17/h2-7H,8-11,13-14H2,1H3,(H,22,23) |
| InChIKey | DCGGZFITJXCORB-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 54.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.39 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|