C16H22F2IN5O — CID 84585673
1-[2-(3,4-difluorophenyl)propyl]-3-ethyl-2-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]guanidine;hydroiodide (PubChem CID 84585673) has the molecular formula C16H22F2IN5O and a molecular weight of 465.29 g/mol. Its IUPAC name is 1-[2-(3,4-difluorophenyl)propyl]-3-ethyl-2-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(3,4-difluorophenyl)propyl]-3-ethyl-2-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 84585673 |
| Molecular Formula | C16H22F2IN5O |
| Molecular Weight | 465.29 g/mol |
| Exact Mass | 465.08 |
| IUPAC Name | 1-[2-(3,4-difluorophenyl)propyl]-3-ethyl-2-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1nc(C)no1)NCC(C)c1ccc(F)c(F)c1.I |
| InChI | InChI=1S/C16H21F2N5O.HI/c1-4-19-16(21-9-15-22-11(3)23-24-15)20-8-10(2)12-5-6-13(17)14(18)7-12;/h5-7,10H,4,8-9H2,1-3H3,(H2,19,20,21);1H |
| InChIKey | MVLGOPYNJPCCAS-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 75.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.29 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|