C18H24F3N5O — CID 111711621
1-ethyl-2-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-3-[3-[3-(trifluoromethyl)phenyl]butyl]guanidine (PubChem CID 111711621) has the molecular formula C18H24F3N5O and a molecular weight of 383.42 g/mol. Its IUPAC name is 1-ethyl-2-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-3-[3-[3-(trifluoromethyl)phenyl]butyl]guanidine.
| Compound Name | 1-ethyl-2-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-3-[3-[3-(trifluoromethyl)phenyl]butyl]guanidine |
|---|---|
| PubChem CID | 111711621 |
| Molecular Formula | C18H24F3N5O |
| Molecular Weight | 383.42 g/mol |
| Exact Mass | 383.19 |
| IUPAC Name | 1-ethyl-2-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-3-[3-[3-(trifluoromethyl)phenyl]butyl]guanidine |
| SMILES | CCN/C(=N\Cc1nc(C)no1)NCCC(C)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H24F3N5O/c1-4-22-17(24-11-16-25-13(3)26-27-16)23-9-8-12(2)14-6-5-7-15(10-14)18(19,20)21/h5-7,10,12H,4,8-9,11H2,1-3H3,(H2,22,23,24) |
| InChIKey | GRXIEPVOJMKIFV-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 75.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.42 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|