C21H31F3N6 — CID 111711749
1-butyl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-[3-[3-(trifluoromethyl)phenyl]butyl]guanidine (PubChem CID 111711749) has the molecular formula C21H31F3N6 and a molecular weight of 424.52 g/mol. Its IUPAC name is 1-butyl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-[3-[3-(trifluoromethyl)phenyl]butyl]guanidine.
| Compound Name | 1-butyl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-[3-[3-(trifluoromethyl)phenyl]butyl]guanidine |
|---|---|
| PubChem CID | 111711749 |
| Molecular Formula | C21H31F3N6 |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.26 |
| IUPAC Name | 1-butyl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-[3-[3-(trifluoromethyl)phenyl]butyl]guanidine |
| SMILES | CCCCN/C(=N\Cc1nnc(C)n1C)NCCC(C)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H31F3N6/c1-5-6-11-25-20(27-14-19-29-28-16(3)30(19)4)26-12-10-15(2)17-8-7-9-18(13-17)21(22,23)24/h7-9,13,15H,5-6,10-12,14H2,1-4H3,(H2,25,26,27) |
| InChIKey | KWWCEBXYABSTQH-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|