C18H25F3N6S — CID 111770125
1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(3-methylsulfanylpropyl)-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine (PubChem CID 111770125) has the molecular formula C18H25F3N6S and a molecular weight of 414.50 g/mol. Its IUPAC name is 1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(3-methylsulfanylpropyl)-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine.
| Compound Name | 1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(3-methylsulfanylpropyl)-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111770125 |
| Molecular Formula | C18H25F3N6S |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | 1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(3-methylsulfanylpropyl)-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine |
| SMILES | CSCCCN/C(=N\Cc1cccc(C(F)(F)F)c1)NCc1nnc(C)n1C |
| InChI | InChI=1S/C18H25F3N6S/c1-13-25-26-16(27(13)2)12-24-17(22-8-5-9-28-3)23-11-14-6-4-7-15(10-14)18(19,20)21/h4,6-7,10H,5,8-9,11-12H2,1-3H3,(H2,22,23,24) |
| InChIKey | BVDCHWHFBGFFBD-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|