C18H27FN6O — CID 111878111
1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(3-ethoxypropyl)-2-[(3-fluorophenyl)methyl]guanidine (PubChem CID 111878111) has the molecular formula C18H27FN6O and a molecular weight of 362.45 g/mol. Its IUPAC name is 1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(3-ethoxypropyl)-2-[(3-fluorophenyl)methyl]guanidine.
| Compound Name | 1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(3-ethoxypropyl)-2-[(3-fluorophenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111878111 |
| Molecular Formula | C18H27FN6O |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.22 |
| IUPAC Name | 1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(3-ethoxypropyl)-2-[(3-fluorophenyl)methyl]guanidine |
| SMILES | CCOCCCN/C(=N\Cc1cccc(F)c1)NCc1nnc(C)n1C |
| InChI | InChI=1S/C18H27FN6O/c1-4-26-10-6-9-20-18(21-12-15-7-5-8-16(19)11-15)22-13-17-24-23-14(2)25(17)3/h5,7-8,11H,4,6,9-10,12-13H2,1-3H3,(H2,20,21,22) |
| InChIKey | AZEFFEHGEVLCRY-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|