C18H29IN6 — CID 111900312
1-butyl-3-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-2-[(3-methylphenyl)methyl]guanidine;hydroiodide (PubChem CID 111900312) has the molecular formula C18H29IN6 and a molecular weight of 456.38 g/mol. Its IUPAC name is 1-butyl-3-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-2-[(3-methylphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-butyl-3-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-2-[(3-methylphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111900312 |
| Molecular Formula | C18H29IN6 |
| Molecular Weight | 456.38 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | 1-butyl-3-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-2-[(3-methylphenyl)methyl]guanidine;hydroiodide |
| SMILES | CCCCN/C(=N\Cc1cccc(C)c1)NCc1nnc(C)n1C.I |
| InChI | InChI=1S/C18H28N6.HI/c1-5-6-10-19-18(20-12-16-9-7-8-14(2)11-16)21-13-17-23-22-15(3)24(17)4;/h7-9,11H,5-6,10,12-13H2,1-4H3,(H2,19,20,21);1H |
| InChIKey | GJBKAMZBCKEROQ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.38 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|