C20H30FN7O — CID 111878109
1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-2-[(3-fluorophenyl)methyl]-3-(3-morpholin-4-ylpropyl)guanidine (PubChem CID 111878109) has the molecular formula C20H30FN7O and a molecular weight of 403.51 g/mol. Its IUPAC name is 1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-2-[(3-fluorophenyl)methyl]-3-(3-morpholin-4-ylpropyl)guanidine.
| Compound Name | 1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-2-[(3-fluorophenyl)methyl]-3-(3-morpholin-4-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111878109 |
| Molecular Formula | C20H30FN7O |
| Molecular Weight | 403.51 g/mol |
| Exact Mass | 403.25 |
| IUPAC Name | 1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-2-[(3-fluorophenyl)methyl]-3-(3-morpholin-4-ylpropyl)guanidine |
| SMILES | Cc1nnc(CN/C(=N/Cc2cccc(F)c2)NCCCN2CCOCC2)n1C |
| InChI | InChI=1S/C20H30FN7O/c1-16-25-26-19(27(16)2)15-24-20(23-14-17-5-3-6-18(21)13-17)22-7-4-8-28-9-11-29-12-10-28/h3,5-6,13H,4,7-12,14-15H2,1-2H3,(H2,22,23,24) |
| InChIKey | MJSVBKXZVQNSNJ-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 79.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.51 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|