C22H35N7O3 — CID 111201664
2-[(3,4-dimethoxyphenyl)methyl]-1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(3-morpholin-4-ylpropyl)guanidine (PubChem CID 111201664) has the molecular formula C22H35N7O3 and a molecular weight of 445.57 g/mol. Its IUPAC name is 2-[(3,4-dimethoxyphenyl)methyl]-1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(3-morpholin-4-ylpropyl)guanidine.
| Compound Name | 2-[(3,4-dimethoxyphenyl)methyl]-1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(3-morpholin-4-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111201664 |
| Molecular Formula | C22H35N7O3 |
| Molecular Weight | 445.57 g/mol |
| Exact Mass | 445.28 |
| IUPAC Name | 2-[(3,4-dimethoxyphenyl)methyl]-1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(3-morpholin-4-ylpropyl)guanidine |
| SMILES | COc1ccc(C/N=C(\NCCCN2CCOCC2)NCc2nnc(C)n2C)cc1OC |
| InChI | InChI=1S/C22H35N7O3/c1-17-26-27-21(28(17)2)16-25-22(23-8-5-9-29-10-12-32-13-11-29)24-15-18-6-7-19(30-3)20(14-18)31-4/h6-7,14H,5,8-13,15-16H2,1-4H3,(H2,23,24,25) |
| InChIKey | YCZUBDRCUOIJFK-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 98.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.57 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|