C22H35FIN7O2 — CID 111681259
2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-[2-(3-fluorophenoxy)propyl]-3-(3-morpholin-4-ylpropyl)guanidine;hydroiodide (PubChem CID 111681259) has the molecular formula C22H35FIN7O2 and a molecular weight of 575.47 g/mol. Its IUPAC name is 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-[2-(3-fluorophenoxy)propyl]-3-(3-morpholin-4-ylpropyl)guanidine;hydroiodide.
| Compound Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-[2-(3-fluorophenoxy)propyl]-3-(3-morpholin-4-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111681259 |
| Molecular Formula | C22H35FIN7O2 |
| Molecular Weight | 575.47 g/mol |
| Exact Mass | 575.19 |
| IUPAC Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-[2-(3-fluorophenoxy)propyl]-3-(3-morpholin-4-ylpropyl)guanidine;hydroiodide |
| SMILES | Cc1nnc(C/N=C(\NCCCN2CCOCC2)NCC(C)Oc2cccc(F)c2)n1C.I |
| InChI | InChI=1S/C22H34FN7O2.HI/c1-17(32-20-7-4-6-19(23)14-20)15-25-22(26-16-21-28-27-18(2)29(21)3)24-8-5-9-30-10-12-31-13-11-30;/h4,6-7,14,17H,5,8-13,15-16H2,1-3H3,(H2,24,25,26);1H |
| InChIKey | CBDNSUWRTRWKEU-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 88.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.47 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|