C17H33N7O — CID 110944358
1-butan-2-yl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(3-morpholin-4-ylpropyl)guanidine (PubChem CID 110944358) has the molecular formula C17H33N7O and a molecular weight of 351.50 g/mol. Its IUPAC name is 1-butan-2-yl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(3-morpholin-4-ylpropyl)guanidine.
| Compound Name | 1-butan-2-yl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(3-morpholin-4-ylpropyl)guanidine |
|---|---|
| PubChem CID | 110944358 |
| Molecular Formula | C17H33N7O |
| Molecular Weight | 351.50 g/mol |
| Exact Mass | 351.27 |
| IUPAC Name | 1-butan-2-yl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(3-morpholin-4-ylpropyl)guanidine |
| SMILES | CCC(C)N/C(=N\Cc1nnc(C)n1C)NCCCN1CCOCC1 |
| InChI | InChI=1S/C17H33N7O/c1-5-14(2)20-17(19-13-16-22-21-15(3)23(16)4)18-7-6-8-24-9-11-25-12-10-24/h14H,5-13H2,1-4H3,(H2,18,19,20) |
| InChIKey | CIGZLRZPWDZUMR-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 79.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.50 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|