C21H32ClN7O — CID 111883331
1-[2-(2-chlorophenyl)ethyl]-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(3-morpholin-4-ylpropyl)guanidine (PubChem CID 111883331) has the molecular formula C21H32ClN7O and a molecular weight of 433.99 g/mol. Its IUPAC name is 1-[2-(2-chlorophenyl)ethyl]-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(3-morpholin-4-ylpropyl)guanidine.
| Compound Name | 1-[2-(2-chlorophenyl)ethyl]-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(3-morpholin-4-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111883331 |
| Molecular Formula | C21H32ClN7O |
| Molecular Weight | 433.99 g/mol |
| Exact Mass | 433.24 |
| IUPAC Name | 1-[2-(2-chlorophenyl)ethyl]-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(3-morpholin-4-ylpropyl)guanidine |
| SMILES | Cc1nnc(C/N=C(\NCCCN2CCOCC2)NCCc2ccccc2Cl)n1C |
| InChI | InChI=1S/C21H32ClN7O/c1-17-26-27-20(28(17)2)16-25-21(23-9-5-11-29-12-14-30-15-13-29)24-10-8-18-6-3-4-7-19(18)22/h3-4,6-7H,5,8-16H2,1-2H3,(H2,23,24,25) |
| InChIKey | QUQAROKHRJEMBC-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 79.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.99 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|