C20H39N7O2 — CID 111712511
2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-[2-(2-hydroxyethyl)pentyl]-3-(3-morpholin-4-ylpropyl)guanidine (PubChem CID 111712511) has the molecular formula C20H39N7O2 and a molecular weight of 409.58 g/mol. Its IUPAC name is 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-[2-(2-hydroxyethyl)pentyl]-3-(3-morpholin-4-ylpropyl)guanidine.
| Compound Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-[2-(2-hydroxyethyl)pentyl]-3-(3-morpholin-4-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111712511 |
| Molecular Formula | C20H39N7O2 |
| Molecular Weight | 409.58 g/mol |
| Exact Mass | 409.32 |
| IUPAC Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-[2-(2-hydroxyethyl)pentyl]-3-(3-morpholin-4-ylpropyl)guanidine |
| SMILES | CCCC(CCO)CN/C(=N\Cc1nnc(C)n1C)NCCCN1CCOCC1 |
| InChI | InChI=1S/C20H39N7O2/c1-4-6-18(7-12-28)15-22-20(23-16-19-25-24-17(2)26(19)3)21-8-5-9-27-10-13-29-14-11-27/h18,28H,4-16H2,1-3H3,(H2,21,22,23) |
| InChIKey | NBLZMYIWQKVJTE-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 99.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.58 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|