C21H42IN7O — CID 111173044
2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-(6-methylheptan-2-yl)-3-(3-morpholin-4-ylpropyl)guanidine;hydroiodide (PubChem CID 111173044) has the molecular formula C21H42IN7O and a molecular weight of 535.52 g/mol. Its IUPAC name is 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-(6-methylheptan-2-yl)-3-(3-morpholin-4-ylpropyl)guanidine;hydroiodide.
| Compound Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-(6-methylheptan-2-yl)-3-(3-morpholin-4-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111173044 |
| Molecular Formula | C21H42IN7O |
| Molecular Weight | 535.52 g/mol |
| Exact Mass | 535.25 |
| IUPAC Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-(6-methylheptan-2-yl)-3-(3-morpholin-4-ylpropyl)guanidine;hydroiodide |
| SMILES | Cc1nnc(C/N=C(/NCCCN2CCOCC2)NC(C)CCCC(C)C)n1C.I |
| InChI | InChI=1S/C21H41N7O.HI/c1-17(2)8-6-9-18(3)24-21(23-16-20-26-25-19(4)27(20)5)22-10-7-11-28-12-14-29-15-13-28;/h17-18H,6-16H2,1-5H3,(H2,22,23,24);1H |
| InChIKey | YSGLVOWARXANPQ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 79.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.52 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|