C21H30F3N7 — CID 111841588
1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-[(1-ethylpyrrolidin-2-yl)methyl]-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine (PubChem CID 111841588) has the molecular formula C21H30F3N7 and a molecular weight of 437.51 g/mol. Its IUPAC name is 1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-[(1-ethylpyrrolidin-2-yl)methyl]-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine.
| Compound Name | 1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-[(1-ethylpyrrolidin-2-yl)methyl]-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111841588 |
| Molecular Formula | C21H30F3N7 |
| Molecular Weight | 437.51 g/mol |
| Exact Mass | 437.25 |
| IUPAC Name | 1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-[(1-ethylpyrrolidin-2-yl)methyl]-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine |
| SMILES | CCN1CCCC1CN/C(=N\Cc1cccc(C(F)(F)F)c1)NCc1nnc(C)n1C |
| InChI | InChI=1S/C21H30F3N7/c1-4-31-10-6-9-18(31)13-26-20(27-14-19-29-28-15(2)30(19)3)25-12-16-7-5-8-17(11-16)21(22,23)24/h5,7-8,11,18H,4,6,9-10,12-14H2,1-3H3,(H2,25,26,27) |
| InChIKey | QOVWKVRQSJMDEE-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 70.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.51 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|